C14H15F2NO3 — CID 61410094
ethyl 2-[cyclopropyl-(3,4-difluorobenzoyl)amino]acetate (PubChem CID 61410094) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-(3,4-difluorobenzoyl)amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl-(3,4-difluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 61410094 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl 2-[cyclopropyl-(3,4-difluorobenzoyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1ccc(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C14H15F2NO3/c1-2-20-13(18)8-17(10-4-5-10)14(19)9-3-6-11(15)12(16)7-9/h3,6-7,10H,2,4-5,8H2,1H3 |
| InChIKey | ZURYVLZRGNXPFS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |