C16H20F2N2O3 — CID 110868280
ethyl 4-[(3,4-difluorobenzoyl)-methylamino]piperidine-1-carboxylate (PubChem CID 110868280) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is ethyl 4-[(3,4-difluorobenzoyl)-methylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3,4-difluorobenzoyl)-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110868280 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 4-[(3,4-difluorobenzoyl)-methylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N(C)C(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-3-23-16(22)20-8-6-12(7-9-20)19(2)15(21)11-4-5-13(17)14(18)10-11/h4-5,10,12H,3,6-9H2,1-2H3 |
| InChIKey | ZKZDFHJZPYWCIS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |