C14H16INO3 — CID 61400649
ethyl 2-[cyclopropyl-(3-iodobenzoyl)amino]acetate (PubChem CID 61400649) has the molecular formula C14H16INO3 and a molecular weight of 373.19 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-(3-iodobenzoyl)amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl-(3-iodobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 61400649 |
| Molecular Formula | C14H16INO3 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | ethyl 2-[cyclopropyl-(3-iodobenzoyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1cccc(I)c1)C1CC1 |
| InChI | InChI=1S/C14H16INO3/c1-2-19-13(17)9-16(12-6-7-12)14(18)10-4-3-5-11(15)8-10/h3-5,8,12H,2,6-7,9H2,1H3 |
| InChIKey | JRLDQMTZXWWURX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|