C15H17F2NO3 — CID 82799836
ethyl 2-[cyclopropyl-(2,6-difluoro-3-methylbenzoyl)amino]acetate (PubChem CID 82799836) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-(2,6-difluoro-3-methylbenzoyl)amino]acetate.
| Compound Name | ethyl 2-[cyclopropyl-(2,6-difluoro-3-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 82799836 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl 2-[cyclopropyl-(2,6-difluoro-3-methylbenzoyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1c(F)ccc(C)c1F)C1CC1 |
| InChI | InChI=1S/C15H17F2NO3/c1-3-21-12(19)8-18(10-5-6-10)15(20)13-11(16)7-4-9(2)14(13)17/h4,7,10H,3,5-6,8H2,1-2H3 |
| InChIKey | SFSRSRUAYIXOPY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |