C14H17ClFNO2 — CID 60697155
ethyl 2-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]acetate (PubChem CID 60697155) has the molecular formula C14H17ClFNO2 and a molecular weight of 285.75 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]acetate.
| Compound Name | ethyl 2-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]acetate |
|---|---|
| PubChem CID | 60697155 |
| Molecular Formula | C14H17ClFNO2 |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | ethyl 2-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]acetate |
| SMILES | CCOC(=O)CN(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C14H17ClFNO2/c1-2-19-14(18)9-17(10-6-7-10)8-11-12(15)4-3-5-13(11)16/h3-5,10H,2,6-9H2,1H3 |
| InChIKey | MWYJFJJOXPIOJG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |