C14H17Cl2NO4 — CID 171623851
ethyl 2-(2,6-dichloro-N-(2-ethoxy-2-oxoethyl)anilino)acetate (PubChem CID 171623851) has the molecular formula C14H17Cl2NO4 and a molecular weight of 334.20 g/mol. Its IUPAC name is ethyl 2-(2,6-dichloro-N-(2-ethoxy-2-oxoethyl)anilino)acetate.
| Compound Name | ethyl 2-(2,6-dichloro-N-(2-ethoxy-2-oxoethyl)anilino)acetate |
|---|---|
| PubChem CID | 171623851 |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | ethyl 2-(2,6-dichloro-N-(2-ethoxy-2-oxoethyl)anilino)acetate |
| SMILES | CCOC(=O)CN(CC(=O)OCC)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H17Cl2NO4/c1-3-20-12(18)8-17(9-13(19)21-4-2)14-10(15)6-5-7-11(14)16/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | QZTIYPOLBOKZAA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |