C18H27NO4 — CID 57065804
ethyl 2-(N-(2-ethoxy-2-oxoethyl)-2,6-diethylanilino)acetate (PubChem CID 57065804) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is ethyl 2-(N-(2-ethoxy-2-oxoethyl)-2,6-diethylanilino)acetate.
| Compound Name | ethyl 2-(N-(2-ethoxy-2-oxoethyl)-2,6-diethylanilino)acetate |
|---|---|
| PubChem CID | 57065804 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | ethyl 2-(N-(2-ethoxy-2-oxoethyl)-2,6-diethylanilino)acetate |
| SMILES | CCOC(=O)CN(CC(=O)OCC)c1c(CC)cccc1CC |
| InChI | InChI=1S/C18H27NO4/c1-5-14-10-9-11-15(6-2)18(14)19(12-16(20)22-7-3)13-17(21)23-8-4/h9-11H,5-8,12-13H2,1-4H3 |
| InChIKey | FWGUENASAWRWNH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |