C17H24ClN5O — CID 46858143
1-(3-chloro-4-methylphenyl)-N-[2-(diethylamino)ethyl]-5-methyltriazole-4-carboxamide (PubChem CID 46858143) has the molecular formula C17H24ClN5O and a molecular weight of 349.87 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-N-[2-(diethylamino)ethyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-chloro-4-methylphenyl)-N-[2-(diethylamino)ethyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46858143 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-N-[2-(diethylamino)ethyl]-5-methyltriazole-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1nnn(-c2ccc(C)c(Cl)c2)c1C |
| InChI | InChI=1S/C17H24ClN5O/c1-5-22(6-2)10-9-19-17(24)16-13(4)23(21-20-16)14-8-7-12(3)15(18)11-14/h7-8,11H,5-6,9-10H2,1-4H3,(H,19,24) |
| InChIKey | KLPAOFIYXWDZSQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |