C15H20ClN5O2 — CID 46857997
1-(5-chloro-2-methoxyphenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide (PubChem CID 46857997) has the molecular formula C15H20ClN5O2 and a molecular weight of 337.81 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46857997 |
| Molecular Formula | C15H20ClN5O2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-[2-(dimethylamino)ethyl]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1-n1nnc(C(=O)NCCN(C)C)c1C |
| InChI | InChI=1S/C15H20ClN5O2/c1-10-14(15(22)17-7-8-20(2)3)18-19-21(10)12-9-11(16)5-6-13(12)23-4/h5-6,9H,7-8H2,1-4H3,(H,17,22) |
| InChIKey | HPYWZYATMXKBKZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |