C18H16ClFN4O2 — CID 46857970
1-(5-chloro-2-methoxyphenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide (PubChem CID 46857970) has the molecular formula C18H16ClFN4O2 and a molecular weight of 374.80 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46857970 |
| Molecular Formula | C18H16ClFN4O2 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1-n1nnc(C(=O)NCc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C18H16ClFN4O2/c1-11-17(18(25)21-10-12-3-6-14(20)7-4-12)22-23-24(11)15-9-13(19)5-8-16(15)26-2/h3-9H,10H2,1-2H3,(H,21,25) |
| InChIKey | DRNSFNZXEKDDJO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |