C19H23ClN4O2 — CID 46857958
1-(5-chloro-2-methoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-5-methyltriazole-4-carboxamide (PubChem CID 46857958) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46857958 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-[2-(cyclohexen-1-yl)ethyl]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1-n1nnc(C(=O)NCCC2=CCCCC2)c1C |
| InChI | InChI=1S/C19H23ClN4O2/c1-13-18(19(25)21-11-10-14-6-4-3-5-7-14)22-23-24(13)16-12-15(20)8-9-17(16)26-2/h6,8-9,12H,3-5,7,10-11H2,1-2H3,(H,21,25) |
| InChIKey | JOQKFRUZTXCPBS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|