C17H14BrFN4O — CID 46858215
1-(4-bromophenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide (PubChem CID 46858215) has the molecular formula C17H14BrFN4O and a molecular weight of 389.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46858215 |
| Molecular Formula | C17H14BrFN4O |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1-(4-bromophenyl)-N-[(4-fluorophenyl)methyl]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc(F)cc2)nnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrFN4O/c1-11-16(17(24)20-10-12-2-6-14(19)7-3-12)21-22-23(11)15-8-4-13(18)5-9-15/h2-9H,10H2,1H3,(H,20,24) |
| InChIKey | UXXIXAISNUJSQT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |