C20H21BrN4O3 — CID 46858245
1-(4-bromophenyl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide (PubChem CID 46858245) has the molecular formula C20H21BrN4O3 and a molecular weight of 445.32 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46858245 |
| Molecular Formula | C20H21BrN4O3 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 1-(4-bromophenyl)-N-[(3-ethoxy-4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide |
| SMILES | CCOc1cc(CNC(=O)c2nnn(-c3ccc(Br)cc3)c2C)ccc1OC |
| InChI | InChI=1S/C20H21BrN4O3/c1-4-28-18-11-14(5-10-17(18)27-3)12-22-20(26)19-13(2)25(24-23-19)16-8-6-15(21)7-9-16/h5-11H,4,12H2,1-3H3,(H,22,26) |
| InChIKey | MBMOMPZGFIWMEP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |