C13H15FN4OS — CID 86928675
1-(4-fluorophenyl)-5-methyl-N-(2-methylsulfanylethyl)triazole-4-carboxamide (PubChem CID 86928675) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-N-(2-methylsulfanylethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-N-(2-methylsulfanylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 86928675 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-N-(2-methylsulfanylethyl)triazole-4-carboxamide |
| SMILES | CSCCNC(=O)c1nnn(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C13H15FN4OS/c1-9-12(13(19)15-7-8-20-2)16-17-18(9)11-5-3-10(14)4-6-11/h3-6H,7-8H2,1-2H3,(H,15,19) |
| InChIKey | ZSFHVGWQWITELF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|