C18H18FN5O3S — CID 78856391
N-[2-(benzenesulfonamido)ethyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide (PubChem CID 78856391) has the molecular formula C18H18FN5O3S and a molecular weight of 403.44 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 78856391 |
| Molecular Formula | C18H18FN5O3S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-1-(4-fluorophenyl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCNS(=O)(=O)c2ccccc2)nnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN5O3S/c1-13-17(22-23-24(13)15-9-7-14(19)8-10-15)18(25)20-11-12-21-28(26,27)16-5-3-2-4-6-16/h2-10,21H,11-12H2,1H3,(H,20,25) |
| InChIKey | SIYDUJUSKYLVAZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|