C20H18FN5O — CID 49408095
N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-1-phenyltriazole-4-carboxamide (PubChem CID 49408095) has the molecular formula C20H18FN5O and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-1-phenyltriazole-4-carboxamide.
| Compound Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 49408095 |
| Molecular Formula | C20H18FN5O |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[2-(6-fluoro-1H-indol-3-yl)ethyl]-5-methyl-1-phenyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCc2c[nH]c3cc(F)ccc23)nnn1-c1ccccc1 |
| InChI | InChI=1S/C20H18FN5O/c1-13-19(24-25-26(13)16-5-3-2-4-6-16)20(27)22-10-9-14-12-23-18-11-15(21)7-8-17(14)18/h2-8,11-12,23H,9-10H2,1H3,(H,22,27) |
| InChIKey | UIWPAYRYZIKKFN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |