C21H18ClN5O2 — CID 162624532
1-(7-chloroquinolin-4-yl)-N-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide (PubChem CID 162624532) has the molecular formula C21H18ClN5O2 and a molecular weight of 407.86 g/mol. Its IUPAC name is 1-(7-chloroquinolin-4-yl)-N-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(7-chloroquinolin-4-yl)-N-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 162624532 |
| Molecular Formula | C21H18ClN5O2 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-(7-chloroquinolin-4-yl)-N-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2nnn(-c3ccnc4cc(Cl)ccc34)c2C)cc1 |
| InChI | InChI=1S/C21H18ClN5O2/c1-13-20(21(28)24-12-14-3-6-16(29-2)7-4-14)25-26-27(13)19-9-10-23-18-11-15(22)5-8-17(18)19/h3-11H,12H2,1-2H3,(H,24,28) |
| InChIKey | SVJJXBAHZZVFPI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |