C18H23ClN4O2 — CID 46857957
1-(5-chloro-2-methoxyphenyl)-N-cycloheptyl-5-methyltriazole-4-carboxamide (PubChem CID 46857957) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N-cycloheptyl-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N-cycloheptyl-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46857957 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N-cycloheptyl-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1-n1nnc(C(=O)NC2CCCCCC2)c1C |
| InChI | InChI=1S/C18H23ClN4O2/c1-12-17(18(24)20-14-7-5-3-4-6-8-14)21-22-23(12)15-11-13(19)9-10-16(15)25-2/h9-11,14H,3-8H2,1-2H3,(H,20,24) |
| InChIKey | QMOQZMXSPICKIF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |