C18H26BrN5O — CID 55874451
1-(3-bromophenyl)-N-[2-[di(propan-2-yl)amino]ethyl]-5-methyltriazole-4-carboxamide (PubChem CID 55874451) has the molecular formula C18H26BrN5O and a molecular weight of 408.34 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[2-[di(propan-2-yl)amino]ethyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-[2-[di(propan-2-yl)amino]ethyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55874451 |
| Molecular Formula | C18H26BrN5O |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(3-bromophenyl)-N-[2-[di(propan-2-yl)amino]ethyl]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN(C(C)C)C(C)C)nnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C18H26BrN5O/c1-12(2)23(13(3)4)10-9-20-18(25)17-14(5)24(22-21-17)16-8-6-7-15(19)11-16/h6-8,11-13H,9-10H2,1-5H3,(H,20,25) |
| InChIKey | WLLMOAONZZZUDH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |