C15H11Br2N5O2S — CID 55882084
1-(3-bromophenyl)-N'-(5-bromothiophene-2-carbonyl)-5-methyltriazole-4-carbohydrazide (PubChem CID 55882084) has the molecular formula C15H11Br2N5O2S and a molecular weight of 485.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N'-(5-bromothiophene-2-carbonyl)-5-methyltriazole-4-carbohydrazide.
| Compound Name | 1-(3-bromophenyl)-N'-(5-bromothiophene-2-carbonyl)-5-methyltriazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55882084 |
| Molecular Formula | C15H11Br2N5O2S |
| Molecular Weight | 485.16 g/mol |
| Exact Mass | 482.90 |
| IUPAC Name | 1-(3-bromophenyl)-N'-(5-bromothiophene-2-carbonyl)-5-methyltriazole-4-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(Br)s2)nnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C15H11Br2N5O2S/c1-8-13(18-21-22(8)10-4-2-3-9(16)7-10)15(24)20-19-14(23)11-5-6-12(17)25-11/h2-7H,1H3,(H,19,23)(H,20,24) |
| InChIKey | OWFLAWQRGQLAAR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|