C16H14BrN5O — CID 55870754
1-(3-bromophenyl)-5-methyl-N-(3-methyl-2-pyridinyl)triazole-4-carboxamide (PubChem CID 55870754) has the molecular formula C16H14BrN5O and a molecular weight of 372.23 g/mol. Its IUPAC name is 1-(3-bromophenyl)-5-methyl-N-(3-methyl-2-pyridinyl)triazole-4-carboxamide.
| Compound Name | 1-(3-bromophenyl)-5-methyl-N-(3-methyl-2-pyridinyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 55870754 |
| Molecular Formula | C16H14BrN5O |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 1-(3-bromophenyl)-5-methyl-N-(3-methyl-2-pyridinyl)triazole-4-carboxamide |
| SMILES | Cc1cccnc1NC(=O)c1nnn(-c2cccc(Br)c2)c1C |
| InChI | InChI=1S/C16H14BrN5O/c1-10-5-4-8-18-15(10)19-16(23)14-11(2)22(21-20-14)13-7-3-6-12(17)9-13/h3-9H,1-2H3,(H,18,19,23) |
| InChIKey | PEXAGPINEINOGY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |