C14H17BrN4O — CID 47299654
1-(3-bromophenyl)-N-tert-butyl-5-methyltriazole-4-carboxamide (PubChem CID 47299654) has the molecular formula C14H17BrN4O and a molecular weight of 337.22 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-tert-butyl-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-tert-butyl-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 47299654 |
| Molecular Formula | C14H17BrN4O |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-(3-bromophenyl)-N-tert-butyl-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)(C)C)nnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C14H17BrN4O/c1-9-12(13(20)16-14(2,3)4)17-18-19(9)11-7-5-6-10(15)8-11/h5-8H,1-4H3,(H,16,20) |
| InChIKey | GBATYIAMUBBPOJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |