C19H20BrN5O — CID 56586626
N-(3-anilinopropyl)-1-(3-bromophenyl)-5-methyltriazole-4-carboxamide (PubChem CID 56586626) has the molecular formula C19H20BrN5O and a molecular weight of 414.31 g/mol. Its IUPAC name is N-(3-anilinopropyl)-1-(3-bromophenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-(3-anilinopropyl)-1-(3-bromophenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 56586626 |
| Molecular Formula | C19H20BrN5O |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-(3-anilinopropyl)-1-(3-bromophenyl)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCNc2ccccc2)nnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C19H20BrN5O/c1-14-18(23-24-25(14)17-10-5-7-15(20)13-17)19(26)22-12-6-11-21-16-8-3-2-4-9-16/h2-5,7-10,13,21H,6,11-12H2,1H3,(H,22,26) |
| InChIKey | YEQVUXYWYXSSSO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|