C16H20BrN5O — CID 119560541
[1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(methylamino)piperidin-1-yl]methanone (PubChem CID 119560541) has the molecular formula C16H20BrN5O and a molecular weight of 378.27 g/mol. Its IUPAC name is [1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | [1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119560541 |
| Molecular Formula | C16H20BrN5O |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [1-(3-bromophenyl)-5-methyltriazol-4-yl]-[4-(methylamino)piperidin-1-yl]methanone |
| SMILES | CNC1CCN(C(=O)c2nnn(-c3cccc(Br)c3)c2C)CC1 |
| InChI | InChI=1S/C16H20BrN5O/c1-11-15(16(23)21-8-6-13(18-2)7-9-21)19-20-22(11)14-5-3-4-12(17)10-14/h3-5,10,13,18H,6-9H2,1-2H3 |
| InChIKey | CLPLFTZGWFFJKZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |