C19H25BrClN3O — CID 119563231
[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119563231) has the molecular formula C19H25BrClN3O and a molecular weight of 426.79 g/mol. Its IUPAC name is [1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | [1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119563231 |
| Molecular Formula | C19H25BrClN3O |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | [1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-[4-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)c2cc(C)n(-c3cccc(Br)c3)c2C)CC1.Cl |
| InChI | InChI=1S/C19H24BrN3O.ClH/c1-13-11-18(19(24)22-9-7-16(21-3)8-10-22)14(2)23(13)17-6-4-5-15(20)12-17;/h4-6,11-12,16,21H,7-10H2,1-3H3;1H |
| InChIKey | MDGJKAPNKQQREV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|