C18H22BrN3O — CID 119417851
[1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-(1,4-diazepan-1-yl)methanone (PubChem CID 119417851) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is [1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-(1,4-diazepan-1-yl)methanone.
| Compound Name | [1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 119417851 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [1-(3-bromophenyl)-2,5-dimethylpyrrol-3-yl]-(1,4-diazepan-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCNCC2)c(C)n1-c1cccc(Br)c1 |
| InChI | InChI=1S/C18H22BrN3O/c1-13-11-17(18(23)21-9-4-7-20-8-10-21)14(2)22(13)16-6-3-5-15(19)12-16/h3,5-6,11-12,20H,4,7-10H2,1-2H3 |
| InChIKey | BQBODDCRUHSRMK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|