C12H14BrIN2O — CID 113265244
(5-bromo-2-iodophenyl)-(1,4-diazepan-1-yl)methanone (PubChem CID 113265244) has the molecular formula C12H14BrIN2O and a molecular weight of 409.07 g/mol. Its IUPAC name is (5-bromo-2-iodophenyl)-(1,4-diazepan-1-yl)methanone.
| Compound Name | (5-bromo-2-iodophenyl)-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 113265244 |
| Molecular Formula | C12H14BrIN2O |
| Molecular Weight | 409.07 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | (5-bromo-2-iodophenyl)-(1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1cc(Br)ccc1I)N1CCCNCC1 |
| InChI | InChI=1S/C12H14BrIN2O/c13-9-2-3-11(14)10(8-9)12(17)16-6-1-4-15-5-7-16/h2-3,8,15H,1,4-7H2 |
| InChIKey | QOMSWJPLQSILDN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|