C14H15BrN2O2 — CID 119414241
(5-bromo-1-benzofuran-2-yl)-(1,4-diazepan-1-yl)methanone (PubChem CID 119414241) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is (5-bromo-1-benzofuran-2-yl)-(1,4-diazepan-1-yl)methanone.
| Compound Name | (5-bromo-1-benzofuran-2-yl)-(1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 119414241 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | (5-bromo-1-benzofuran-2-yl)-(1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1cc2cc(Br)ccc2o1)N1CCCNCC1 |
| InChI | InChI=1S/C14H15BrN2O2/c15-11-2-3-12-10(8-11)9-13(19-12)14(18)17-6-1-4-16-5-7-17/h2-3,8-9,16H,1,4-7H2 |
| InChIKey | BIOKOPMJSVOZBE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |