C17H19BrN2O2 — CID 52877254
(5-bromo-1-benzofuran-2-yl)-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone (PubChem CID 52877254) has the molecular formula C17H19BrN2O2 and a molecular weight of 363.26 g/mol. Its IUPAC name is (5-bromo-1-benzofuran-2-yl)-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone.
| Compound Name | (5-bromo-1-benzofuran-2-yl)-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 52877254 |
| Molecular Formula | C17H19BrN2O2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (5-bromo-1-benzofuran-2-yl)-[(3S)-3-pyrrolidin-1-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc2cc(Br)ccc2o1)N1CC[C@H](N2CCCC2)C1 |
| InChI | InChI=1S/C17H19BrN2O2/c18-13-3-4-15-12(9-13)10-16(22-15)17(21)20-8-5-14(11-20)19-6-1-2-7-19/h3-4,9-10,14H,1-2,5-8,11H2/t14-/m0/s1 |
| InChIKey | VQZRLKPYHKMMLH-AWEZNQCLSA-N |
| XLogP | 3.51 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |