C14H13BrN2O3 — CID 95118501
(2R)-1-(5-bromo-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 95118501) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is (2R)-1-(5-bromo-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(5-bromo-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95118501 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (2R)-1-(5-bromo-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1C(=O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C14H13BrN2O3/c15-9-3-4-11-8(6-9)7-12(20-11)14(19)17-5-1-2-10(17)13(16)18/h3-4,6-7,10H,1-2,5H2,(H2,16,18)/t10-/m1/s1 |
| InChIKey | GBONBGZVRJMPFN-SNVBAGLBSA-N |
| XLogP | 2.29 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |