C16H17NO4 — CID 61219649
methyl 1-(5-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 61219649) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl 1-(5-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(5-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 61219649 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 1-(5-methyl-1-benzofuran-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)c1cc2cc(C)ccc2o1 |
| InChI | InChI=1S/C16H17NO4/c1-10-5-6-13-11(8-10)9-14(21-13)15(18)17-7-3-4-12(17)16(19)20-2/h5-6,8-9,12H,3-4,7H2,1-2H3 |
| InChIKey | TZIIOHRJPSNFFT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |