C17H18N2O4 — CID 95123862
methyl (2S)-1-(6-methyl-2-oxo-1H-quinoline-4-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 95123862) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is methyl (2S)-1-(6-methyl-2-oxo-1H-quinoline-4-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-(6-methyl-2-oxo-1H-quinoline-4-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 95123862 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | methyl (2S)-1-(6-methyl-2-oxo-1H-quinoline-4-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)c1cc(=O)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C17H18N2O4/c1-10-5-6-13-11(8-10)12(9-15(20)18-13)16(21)19-7-3-4-14(19)17(22)23-2/h5-6,8-9,14H,3-4,7H2,1-2H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | ULMKYRDPEUFKKU-AWEZNQCLSA-N |
| XLogP | 1.61 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |