C19H22FN3O3 — CID 139002167
1-[1-(5-fluoro-1-benzofuran-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 139002167) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-[1-(5-fluoro-1-benzofuran-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[1-(5-fluoro-1-benzofuran-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139002167 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[1-(5-fluoro-1-benzofuran-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C1CCN(C(=O)c2cc3cc(F)ccc3o2)CC1 |
| InChI | InChI=1S/C19H22FN3O3/c20-13-3-4-16-12(10-13)11-17(26-16)19(25)22-8-5-14(6-9-22)23-7-1-2-15(23)18(21)24/h3-4,10-11,14-15H,1-2,5-9H2,(H2,21,24) |
| InChIKey | SEEPCMRCWCROJR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |