C19H22BrFN4O2 — CID 86882605
1-[1-(6-bromo-4-fluoro-1H-indole-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 86882605) has the molecular formula C19H22BrFN4O2 and a molecular weight of 437.31 g/mol. Its IUPAC name is 1-[1-(6-bromo-4-fluoro-1H-indole-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[1-(6-bromo-4-fluoro-1H-indole-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86882605 |
| Molecular Formula | C19H22BrFN4O2 |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1-[1-(6-bromo-4-fluoro-1H-indole-2-carbonyl)piperidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C1CCN(C(=O)c2cc3c(F)cc(Br)cc3[nH]2)CC1 |
| InChI | InChI=1S/C19H22BrFN4O2/c20-11-8-14(21)13-10-16(23-15(13)9-11)19(27)24-6-3-12(4-7-24)25-5-1-2-17(25)18(22)26/h8-10,12,17,23H,1-7H2,(H2,22,26) |
| InChIKey | QVTRGBNYGGMQQA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |