C16H18FN3O2 — CID 119135616
1-(6-fluoro-4-methyl-1H-indole-2-carbonyl)piperidine-4-carboxamide (PubChem CID 119135616) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is 1-(6-fluoro-4-methyl-1H-indole-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | 1-(6-fluoro-4-methyl-1H-indole-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119135616 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-(6-fluoro-4-methyl-1H-indole-2-carbonyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(F)cc2[nH]c(C(=O)N3CCC(C(N)=O)CC3)cc12 |
| InChI | InChI=1S/C16H18FN3O2/c1-9-6-11(17)7-13-12(9)8-14(19-13)16(22)20-4-2-10(3-5-20)15(18)21/h6-8,10,19H,2-5H2,1H3,(H2,18,21) |
| InChIKey | OOFWLUFUHVCXFI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |