About [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone
[(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone (PubChem CID 155954106) has the molecular formula C14H17FN4O
and a molecular weight of 276.31 g/mol. Its IUPAC name is [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone.
Molecular Properties
| Compound Name | [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone |
| PubChem CID | 155954106 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone |
| SMILES | Cc1cc(F)cc2[nH]c(C(=O)N3C[C@@H](N)[C@H](N)C3)cc12 |
| InChI | InChI=1S/C14H17FN4O/c1-7-2-8(15)3-12-9(7)4-13(18-12)14(20)19-5-10(16)11(17)6-19/h2-4,10-11,18H,5-6,16-17H2,1H3/t10-,11-/m1/s1 |
| InChIKey | ZSTMFTIOXAINOE-GHMZBOCLSA-N |
| XLogP | 0.73 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone?
The IUPAC name of [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone (CID 155954106) is [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone.
What is the SMILES notation for [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone?
The canonical SMILES for [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone is Cc1cc(F)cc2[nH]c(C(=O)N3C[C@@H](N)[C@H](N)C3)cc12.
What is the InChIKey of [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone?
The InChIKey is ZSTMFTIOXAINOE-GHMZBOCLSA-N. The full InChI is InChI=1S/C14H17FN4O/c1-7-2-8(15)3-12-9(7)4-13(18-12)14(20)19-5-10(16)11(17)6-19/h2-4,10-11,18H,5-6,16-17H2,1H3/t10-,11-/m1/s1.
What are the key properties of [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone?
[(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone has a molecular weight of 276.31 g/mol, XLogP of 0.73, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-3,4-diaminopyrrolidin-1-yl]-(6-fluoro-4-methyl-1H-indol-2-yl)methanone is sourced from PubChem (CID 155954106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).