C14H17FN2O2 — CID 111433448
6-fluoro-N-(3-hydroxybutyl)-4-methyl-1H-indole-2-carboxamide (PubChem CID 111433448) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 6-fluoro-N-(3-hydroxybutyl)-4-methyl-1H-indole-2-carboxamide.
| Compound Name | 6-fluoro-N-(3-hydroxybutyl)-4-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 111433448 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 6-fluoro-N-(3-hydroxybutyl)-4-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1cc(F)cc2[nH]c(C(=O)NCCC(C)O)cc12 |
| InChI | InChI=1S/C14H17FN2O2/c1-8-5-10(15)6-12-11(8)7-13(17-12)14(19)16-4-3-9(2)18/h5-7,9,17-18H,3-4H2,1-2H3,(H,16,19) |
| InChIKey | NFEWYXAPCAIBFQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |