C11H9ClF2N2O — CID 155963978
4-chloro-6-fluoro-N-(2-fluoroethyl)-1H-indole-2-carboxamide (PubChem CID 155963978) has the molecular formula C11H9ClF2N2O and a molecular weight of 258.66 g/mol. Its IUPAC name is 4-chloro-6-fluoro-N-(2-fluoroethyl)-1H-indole-2-carboxamide.
| Compound Name | 4-chloro-6-fluoro-N-(2-fluoroethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155963978 |
| Molecular Formula | C11H9ClF2N2O |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-chloro-6-fluoro-N-(2-fluoroethyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCCF)c1cc2c(Cl)cc(F)cc2[nH]1 |
| InChI | InChI=1S/C11H9ClF2N2O/c12-8-3-6(14)4-9-7(8)5-10(16-9)11(17)15-2-1-13/h3-5,16H,1-2H2,(H,15,17) |
| InChIKey | OPINCDDZDMJYLW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |