C21H18Cl2N4O — CID 44534616
4,6-dichloro-N-[3-(quinolin-2-ylamino)propyl]-1H-indole-2-carboxamide (PubChem CID 44534616) has the molecular formula C21H18Cl2N4O and a molecular weight of 413.31 g/mol. Its IUPAC name is 4,6-dichloro-N-[3-(quinolin-2-ylamino)propyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dichloro-N-[3-(quinolin-2-ylamino)propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 44534616 |
| Molecular Formula | C21H18Cl2N4O |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4,6-dichloro-N-[3-(quinolin-2-ylamino)propyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCNc1ccc2ccccc2n1)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C21H18Cl2N4O/c22-14-10-16(23)15-12-19(26-18(15)11-14)21(28)25-9-3-8-24-20-7-6-13-4-1-2-5-17(13)27-20/h1-2,4-7,10-12,26H,3,8-9H2,(H,24,27)(H,25,28) |
| InChIKey | KOFMWNXBNGUSOK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|