C15H20N2O2 — CID 11492630
N-(6-hydroxyhexyl)-1H-indole-2-carboxamide (PubChem CID 11492630) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-1H-indole-2-carboxamide.
| Compound Name | N-(6-hydroxyhexyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11492630 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(6-hydroxyhexyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCCCCCCO)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H20N2O2/c18-10-6-2-1-5-9-16-15(19)14-11-12-7-3-4-8-13(12)17-14/h3-4,7-8,11,17-18H,1-2,5-6,9-10H2,(H,16,19) |
| InChIKey | GVXWRMNUFGFSQR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|