C16H20N2O3 — CID 103919131
N-(6-hydroxyhexyl)-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 103919131) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-(6-hydroxyhexyl)-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 103919131 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(6-hydroxyhexyl)-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | O=C(NCCCCCCO)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H20N2O3/c19-10-6-2-1-5-9-17-16(21)14-11-12-7-3-4-8-13(12)15(20)18-14/h3-4,7-8,11,19H,1-2,5-6,9-10H2,(H,17,21)(H,18,20) |
| InChIKey | ULAXPFHVDNPGEI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|