C15H16N2O4 — CID 81064080
3-methyl-4-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]butanoic acid (PubChem CID 81064080) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 3-methyl-4-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]butanoic acid.
| Compound Name | 3-methyl-4-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 81064080 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-methyl-4-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]butanoic acid |
| SMILES | CC(CNC(=O)c1cc2ccccc2c(=O)[nH]1)CC(=O)O |
| InChI | InChI=1S/C15H16N2O4/c1-9(6-13(18)19)8-16-15(21)12-7-10-4-2-3-5-11(10)14(20)17-12/h2-5,7,9H,6,8H2,1H3,(H,16,21)(H,17,20)(H,18,19) |
| InChIKey | AYGDHGKZHGBOPL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |