C19H19N3O2 — CID 24675648
N-[2-(N-methylanilino)ethyl]-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 24675648) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[2-(N-methylanilino)ethyl]-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-[2-(N-methylanilino)ethyl]-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 24675648 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[2-(N-methylanilino)ethyl]-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | CN(CCNC(=O)c1cc2ccccc2c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C19H19N3O2/c1-22(15-8-3-2-4-9-15)12-11-20-19(24)17-13-14-7-5-6-10-16(14)18(23)21-17/h2-10,13H,11-12H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | BMPMOHTZCOJGEL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |