C26H30N4O2 — CID 35617422
1-N,4-N-bis[2-(N-methylanilino)ethyl]benzene-1,4-dicarboxamide (PubChem CID 35617422) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-N,4-N-bis[2-(N-methylanilino)ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-(N-methylanilino)ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 35617422 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-N,4-N-bis[2-(N-methylanilino)ethyl]benzene-1,4-dicarboxamide |
| SMILES | CN(CCNC(=O)c1ccc(C(=O)NCCN(C)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N4O2/c1-29(23-9-5-3-6-10-23)19-17-27-25(31)21-13-15-22(16-14-21)26(32)28-18-20-30(2)24-11-7-4-8-12-24/h3-16H,17-20H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | CRMUCPHGSRGIOA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |