C24H22N4O2 — CID 24607474
N-[2-(N-methylanilino)ethyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 24607474) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[2-(N-methylanilino)ethyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | N-[2-(N-methylanilino)ethyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 24607474 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[2-(N-methylanilino)ethyl]-4-(5-phenyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | CN(CCNC(=O)c1ccc(-c2nnc(-c3ccccc3)o2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O2/c1-28(21-10-6-3-7-11-21)17-16-25-22(29)18-12-14-20(15-13-18)24-27-26-23(30-24)19-8-4-2-5-9-19/h2-15H,16-17H2,1H3,(H,25,29) |
| InChIKey | VXGYWCFJNRASSZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |