C13H12F2N2O3 — CID 103770245
N-(3,3-difluoro-2-hydroxypropyl)-1-oxo-2H-isoquinoline-3-carboxamide (PubChem CID 103770245) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-1-oxo-2H-isoquinoline-3-carboxamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-1-oxo-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 103770245 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-1-oxo-2H-isoquinoline-3-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H12F2N2O3/c14-11(15)10(18)6-16-13(20)9-5-7-3-1-2-4-8(7)12(19)17-9/h1-5,10-11,18H,6H2,(H,16,20)(H,17,19) |
| InChIKey | PQQYSXAVUCQZNR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |