C14H14N2O5 — CID 103879566
methyl 2-hydroxy-3-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]propanoate (PubChem CID 103879566) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103879566 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | methyl 2-hydroxy-3-[(1-oxo-2H-isoquinoline-3-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C14H14N2O5/c1-21-14(20)11(17)7-15-13(19)10-6-8-4-2-3-5-9(8)12(18)16-10/h2-6,11,17H,7H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | RYVNQIOEOWIIDM-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |