C13H13NO4S — CID 103879191
methyl 3-(1-benzothiophene-2-carbonylamino)-2-hydroxypropanoate (PubChem CID 103879191) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is methyl 3-(1-benzothiophene-2-carbonylamino)-2-hydroxypropanoate.
| Compound Name | methyl 3-(1-benzothiophene-2-carbonylamino)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 103879191 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | methyl 3-(1-benzothiophene-2-carbonylamino)-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H13NO4S/c1-18-13(17)9(15)7-14-12(16)11-6-8-4-2-3-5-10(8)19-11/h2-6,9,15H,7H2,1H3,(H,14,16) |
| InChIKey | ICNFZKYYWHIPOW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |