C14H17NO2S — CID 110209283
N-(2-hydroxypentyl)-1-benzothiophene-2-carboxamide (PubChem CID 110209283) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is N-(2-hydroxypentyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-hydroxypentyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 110209283 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-(2-hydroxypentyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(O)CNC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C14H17NO2S/c1-2-5-11(16)9-15-14(17)13-8-10-6-3-4-7-12(10)18-13/h3-4,6-8,11,16H,2,5,9H2,1H3,(H,15,17) |
| InChIKey | XAPWZPJDFCIVLR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |