C15H19NO3S2 — CID 86941343
N-(2-methylpentylsulfonyl)-1-benzothiophene-2-carboxamide (PubChem CID 86941343) has the molecular formula C15H19NO3S2 and a molecular weight of 325.45 g/mol. Its IUPAC name is N-(2-methylpentylsulfonyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-methylpentylsulfonyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 86941343 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-(2-methylpentylsulfonyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(C)CS(=O)(=O)NC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H19NO3S2/c1-3-6-11(2)10-21(18,19)16-15(17)14-9-12-7-4-5-8-13(12)20-14/h4-5,7-9,11H,3,6,10H2,1-2H3,(H,16,17) |
| InChIKey | FALBXJUNPWEVLI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |